About 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone
1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone (PubChem CID 54491707) has the molecular formula C8H9N3O
and a molecular weight of 163.18 g/mol. Its IUPAC name is 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone |
| PubChem CID | 54491707 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone |
| SMILES | [C-]#[N+]c1nn(C)c(C)c1C(C)=O |
| InChI | InChI=1S/C8H9N3O/c1-5-7(6(2)12)8(9-3)10-11(5)4/h1-2,4H3 |
| InChIKey | XWEMDLHCLIXLPK-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 39.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone?
The IUPAC name of 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone (CID 54491707) is 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone.
What is the SMILES notation for 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone?
The canonical SMILES for 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone is [C-]#[N+]c1nn(C)c(C)c1C(C)=O.
What is the InChIKey of 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone?
The InChIKey is XWEMDLHCLIXLPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O/c1-5-7(6(2)12)8(9-3)10-11(5)4/h1-2,4H3.
What are the key properties of 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone?
1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone has a molecular weight of 163.18 g/mol, XLogP of 1.48, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-isocyano-1,5-dimethylpyrazol-4-yl)ethanone is sourced from PubChem (CID 54491707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).