C16H12Cl2O3 — CID 54491823
4-[2-(3,4-dichlorophenyl)phenyl]-4-oxobutanoic acid (PubChem CID 54491823) has the molecular formula C16H12Cl2O3 and a molecular weight of 323.18 g/mol. Its IUPAC name is 4-[2-(3,4-dichlorophenyl)phenyl]-4-oxobutanoic acid.
| Compound Name | 4-[2-(3,4-dichlorophenyl)phenyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 54491823 |
| Molecular Formula | C16H12Cl2O3 |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 4-[2-(3,4-dichlorophenyl)phenyl]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)c1ccccc1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl2O3/c17-13-6-5-10(9-14(13)18)11-3-1-2-4-12(11)15(19)7-8-16(20)21/h1-6,9H,7-8H2,(H,20,21) |
| InChIKey | XWGSFKZANSYDTM-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |