About 5-methyl-4,5-dihydro-1,3-thiazol-2-amine
5-methyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 544920) has the molecular formula C4H8N2S
and a molecular weight of 116.19 g/mol. Its IUPAC name is 5-methyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 5-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 544920 |
| Molecular Formula | C4H8N2S |
| Molecular Weight | 116.19 g/mol |
| Exact Mass | 116.04 |
| IUPAC Name | 5-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CC1CN=C(N)S1 |
| InChI | InChI=1S/C4H8N2S/c1-3-2-6-4(5)7-3/h3H,2H2,1H3,(H2,5,6) |
| InChIKey | IKFLLHVVKJTHAH-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.19 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of 5-methyl-4,5-dihydro-1,3-thiazol-2-amine (CID 544920) is 5-methyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for 5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for 5-methyl-4,5-dihydro-1,3-thiazol-2-amine is CC1CN=C(N)S1.
What is the InChIKey of 5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is IKFLLHVVKJTHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2S/c1-3-2-6-4(5)7-3/h3H,2H2,1H3,(H2,5,6).
What are the key properties of 5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
5-methyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 116.19 g/mol, XLogP of 0.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 544920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).