C7H6F9NOS — CID 54492072
2,2,3,3,4,4,5,5,5-nonafluoro-N-(2-sulfanylethyl)pentanamide (PubChem CID 54492072) has the molecular formula C7H6F9NOS and a molecular weight of 323.18 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-N-(2-sulfanylethyl)pentanamide.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(2-sulfanylethyl)pentanamide |
|---|---|
| PubChem CID | 54492072 |
| Molecular Formula | C7H6F9NOS |
| Molecular Weight | 323.18 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-N-(2-sulfanylethyl)pentanamide |
| SMILES | O=C(NCCS)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H6F9NOS/c8-4(9,3(18)17-1-2-19)5(10,11)6(12,13)7(14,15)16/h19H,1-2H2,(H,17,18) |
| InChIKey | XWKZBPRXBGADLW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|