C11H14F3N3S2 — CID 54492131
3-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-4-(3,3,3-trifluoropropylsulfanyl)-1,2,5-thiadiazole (PubChem CID 54492131) has the molecular formula C11H14F3N3S2 and a molecular weight of 309.38 g/mol. Its IUPAC name is 3-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-4-(3,3,3-trifluoropropylsulfanyl)-1,2,5-thiadiazole.
| Compound Name | 3-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-4-(3,3,3-trifluoropropylsulfanyl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 54492131 |
| Molecular Formula | C11H14F3N3S2 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 3-(6-methyl-1,2,3,6-tetrahydropyridin-5-yl)-4-(3,3,3-trifluoropropylsulfanyl)-1,2,5-thiadiazole |
| SMILES | CC1NCCC=C1c1nsnc1SCCC(F)(F)F |
| InChI | InChI=1S/C11H14F3N3S2/c1-7-8(3-2-5-15-7)9-10(17-19-16-9)18-6-4-11(12,13)14/h3,7,15H,2,4-6H2,1H3 |
| InChIKey | XWMAPXYGYNBABA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |