C13H11N5O4 — CID 54492138
1,1-bis(3-nitrophenyl)guanidine (PubChem CID 54492138) has the molecular formula C13H11N5O4 and a molecular weight of 301.26 g/mol. Its IUPAC name is 1,1-bis(3-nitrophenyl)guanidine.
| Compound Name | 1,1-bis(3-nitrophenyl)guanidine |
|---|---|
| PubChem CID | 54492138 |
| Molecular Formula | C13H11N5O4 |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | 1,1-bis(3-nitrophenyl)guanidine |
| SMILES | [H]/N=C(\N)N(c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H11N5O4/c14-13(15)16(9-3-1-5-11(7-9)17(19)20)10-4-2-6-12(8-10)18(21)22/h1-8H,(H3,14,15) |
| InChIKey | XWMDPKPQYUEAJB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|