C16H21NO2 — CID 54492301
4,5-dimethyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-diene-10,12-diol (PubChem CID 54492301) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 4,5-dimethyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-diene-10,12-diol.
| Compound Name | 4,5-dimethyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-diene-10,12-diol |
|---|---|
| PubChem CID | 54492301 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 4,5-dimethyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-diene-10,12-diol |
| SMILES | CC1C(C)C2CC1C1C3CC(c4c(O)[nH]c(O)c43)C21 |
| InChI | InChI=1S/C16H21NO2/c1-5-6(2)8-3-7(5)11-9-4-10(12(8)11)14-13(9)15(18)17-16(14)19/h5-12,17-19H,3-4H2,1-2H3 |
| InChIKey | XWOTXNFRHLGEPR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|