About piperazin-1-yl acetate
piperazin-1-yl acetate (PubChem CID 54492305) has the molecular formula C6H12N2O2
and a molecular weight of 144.17 g/mol. Its IUPAC name is piperazin-1-yl acetate.
Molecular Properties
| Compound Name | piperazin-1-yl acetate |
| PubChem CID | 54492305 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | piperazin-1-yl acetate |
| SMILES | CC(=O)ON1CCNCC1 |
| InChI | InChI=1S/C6H12N2O2/c1-6(9)10-8-4-2-7-3-5-8/h7H,2-5H2,1H3 |
| InChIKey | NHVRYOFWXIIQKV-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-1-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-1-yl acetate?
The IUPAC name of piperazin-1-yl acetate (CID 54492305) is piperazin-1-yl acetate.
What is the SMILES notation for piperazin-1-yl acetate?
The canonical SMILES for piperazin-1-yl acetate is CC(=O)ON1CCNCC1.
What is the InChIKey of piperazin-1-yl acetate?
The InChIKey is NHVRYOFWXIIQKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2/c1-6(9)10-8-4-2-7-3-5-8/h7H,2-5H2,1H3.
What are the key properties of piperazin-1-yl acetate?
piperazin-1-yl acetate has a molecular weight of 144.17 g/mol, XLogP of -0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-1-yl acetate is sourced from PubChem (CID 54492305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).