C11H20N2O3 — CID 54492613
3-amino-1-(2-methyl-1-methylperoxypropan-2-yl)-4,5-dihydro-3H-azepin-2-one (PubChem CID 54492613) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-amino-1-(2-methyl-1-methylperoxypropan-2-yl)-4,5-dihydro-3H-azepin-2-one.
| Compound Name | 3-amino-1-(2-methyl-1-methylperoxypropan-2-yl)-4,5-dihydro-3H-azepin-2-one |
|---|---|
| PubChem CID | 54492613 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 3-amino-1-(2-methyl-1-methylperoxypropan-2-yl)-4,5-dihydro-3H-azepin-2-one |
| SMILES | COOCC(C)(C)N1C=CCCC(N)C1=O |
| InChI | InChI=1S/C11H20N2O3/c1-11(2,8-16-15-3)13-7-5-4-6-9(12)10(13)14/h5,7,9H,4,6,8,12H2,1-3H3 |
| InChIKey | XWUNXOKFHVFMRN-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|