C30H44F2O6 — CID 54493171
methyl (5R)-5-[(1S,3R,8S,9S,10R,13R,14S,17R)-1,3-diacetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,2-difluorohexanoate (PubChem CID 54493171) has the molecular formula C30H44F2O6 and a molecular weight of 538.67 g/mol. Its IUPAC name is methyl (5R)-5-[(1S,3R,8S,9S,10R,13R,14S,17R)-1,3-diacetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,2-difluorohexanoate.
| Compound Name | methyl (5R)-5-[(1S,3R,8S,9S,10R,13R,14S,17R)-1,3-diacetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,2-difluorohexanoate |
|---|---|
| PubChem CID | 54493171 |
| Molecular Formula | C30H44F2O6 |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | methyl (5R)-5-[(1S,3R,8S,9S,10R,13R,14S,17R)-1,3-diacetyloxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,2-difluorohexanoate |
| SMILES | COC(=O)C(F)(F)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(C)=O)C[C@H](OC(C)=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C30H44F2O6/c1-17(11-14-30(31,32)27(35)36-6)23-9-10-24-22-8-7-20-15-21(37-18(2)33)16-26(38-19(3)34)29(20,5)25(22)12-13-28(23,24)4/h7,17,21-26H,8-16H2,1-6H3/t17-,21-,22+,23-,24+,25+,26+,28-,29+/m1/s1 |
| InChIKey | XXFBBFMVLBUDCL-QNMSKDNQSA-N |
| XLogP | 6.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|