C24H40O4 — CID 54493682
1-O-ethyl 3-O-(3,7,11-trimethyldodeca-1,6,10-trien-3-yl) 2-butan-2-ylpropanedioate (PubChem CID 54493682) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is 1-O-ethyl 3-O-(3,7,11-trimethyldodeca-1,6,10-trien-3-yl) 2-butan-2-ylpropanedioate.
| Compound Name | 1-O-ethyl 3-O-(3,7,11-trimethyldodeca-1,6,10-trien-3-yl) 2-butan-2-ylpropanedioate |
|---|---|
| PubChem CID | 54493682 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 1-O-ethyl 3-O-(3,7,11-trimethyldodeca-1,6,10-trien-3-yl) 2-butan-2-ylpropanedioate |
| SMILES | C=CC(C)(CCC=C(C)CCC=C(C)C)OC(=O)C(C(=O)OCC)C(C)CC |
| InChI | InChI=1S/C24H40O4/c1-9-20(7)21(22(25)27-11-3)23(26)28-24(8,10-2)17-13-16-19(6)15-12-14-18(4)5/h10,14,16,20-21H,2,9,11-13,15,17H2,1,3-8H3 |
| InChIKey | XXOIVCSZMUAZFK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|