About 1,5-dimethylpyrazole-3,4-diamine
1,5-dimethylpyrazole-3,4-diamine (PubChem CID 544940) has the molecular formula C5H10N4
and a molecular weight of 126.16 g/mol. Its IUPAC name is 1,5-dimethylpyrazole-3,4-diamine.
Molecular Properties
| Compound Name | 1,5-dimethylpyrazole-3,4-diamine |
| PubChem CID | 544940 |
| Molecular Formula | C5H10N4 |
| Molecular Weight | 126.16 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | 1,5-dimethylpyrazole-3,4-diamine |
| SMILES | Cc1c(N)c(N)nn1C |
| InChI | InChI=1S/C5H10N4/c1-3-4(6)5(7)8-9(3)2/h6H2,1-2H3,(H2,7,8) |
| InChIKey | XDAHPIIGQGPNAS-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.16 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dimethylpyrazole-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethylpyrazole-3,4-diamine?
The IUPAC name of 1,5-dimethylpyrazole-3,4-diamine (CID 544940) is 1,5-dimethylpyrazole-3,4-diamine.
What is the SMILES notation for 1,5-dimethylpyrazole-3,4-diamine?
The canonical SMILES for 1,5-dimethylpyrazole-3,4-diamine is Cc1c(N)c(N)nn1C.
What is the InChIKey of 1,5-dimethylpyrazole-3,4-diamine?
The InChIKey is XDAHPIIGQGPNAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N4/c1-3-4(6)5(7)8-9(3)2/h6H2,1-2H3,(H2,7,8).
What are the key properties of 1,5-dimethylpyrazole-3,4-diamine?
1,5-dimethylpyrazole-3,4-diamine has a molecular weight of 126.16 g/mol, XLogP of -0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethylpyrazole-3,4-diamine is sourced from PubChem (CID 544940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).