C18H16N6 — CID 54494001
3-(2-aminoethyl)-2-(1H-benzimidazol-2-ylmethyl)benzimidazole-5-carbonitrile (PubChem CID 54494001) has the molecular formula C18H16N6 and a molecular weight of 316.37 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2-(1H-benzimidazol-2-ylmethyl)benzimidazole-5-carbonitrile.
| Compound Name | 3-(2-aminoethyl)-2-(1H-benzimidazol-2-ylmethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 54494001 |
| Molecular Formula | C18H16N6 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 3-(2-aminoethyl)-2-(1H-benzimidazol-2-ylmethyl)benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(Cc3nc4ccccc4[nH]3)n(CCN)c2c1 |
| InChI | InChI=1S/C18H16N6/c19-7-8-24-16-9-12(11-20)5-6-15(16)23-18(24)10-17-21-13-3-1-2-4-14(13)22-17/h1-6,9H,7-8,10,19H2,(H,21,22) |
| InChIKey | XXTYIMXRFVRRQP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |