C23H21ClF3NO4 — CID 5449404
3-(2-chlorophenyl)-8-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one (PubChem CID 5449404) has the molecular formula C23H21ClF3NO4 and a molecular weight of 467.87 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-8-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one.
| Compound Name | 3-(2-chlorophenyl)-8-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
|---|---|
| PubChem CID | 5449404 |
| Molecular Formula | C23H21ClF3NO4 |
| Molecular Weight | 467.87 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 3-(2-chlorophenyl)-8-[[(2S,6S)-2,6-dimethylmorpholin-4-yl]methyl]-7-hydroxy-2-(trifluoromethyl)chromen-4-one |
| SMILES | C[C@H]1CN(Cc2c(O)ccc3c(=O)c(-c4ccccc4Cl)c(C(F)(F)F)oc23)C[C@H](C)O1 |
| InChI | InChI=1S/C23H21ClF3NO4/c1-12-9-28(10-13(2)31-12)11-16-18(29)8-7-15-20(30)19(14-5-3-4-6-17(14)24)22(23(25,26)27)32-21(15)16/h3-8,12-13,29H,9-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | SOQQJUCOCSPQGJ-STQMWFEESA-N |
| XLogP | 5.45 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.87 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|