About [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate
[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate (PubChem CID 54494276) has the molecular formula C10H16N2O2
and a molecular weight of 196.25 g/mol. Its IUPAC name is [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate.
Molecular Properties
| Compound Name | [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate |
| PubChem CID | 54494276 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate |
| SMILES | CC(=O)ON=CCC1=CCCN(C)C1 |
| InChI | InChI=1S/C10H16N2O2/c1-9(13)14-11-6-5-10-4-3-7-12(2)8-10/h4,6H,3,5,7-8H2,1-2H3 |
| InChIKey | XXYNQSNGJUYHOV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate?
The IUPAC name of [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate (CID 54494276) is [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate.
What is the SMILES notation for [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate?
The canonical SMILES for [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate is CC(=O)ON=CCC1=CCCN(C)C1.
What is the InChIKey of [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate?
The InChIKey is XXYNQSNGJUYHOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O2/c1-9(13)14-11-6-5-10-4-3-7-12(2)8-10/h4,6H,3,5,7-8H2,1-2H3.
What are the key properties of [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate?
[2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate has a molecular weight of 196.25 g/mol, XLogP of 1.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)ethylideneamino] acetate is sourced from PubChem (CID 54494276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).