About trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol
trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol (PubChem CID 54494610) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol |
| PubChem CID | 54494610 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol |
| SMILES | O[C@H]1CCCC[C@@H]1N1CC=CC1 |
| InChI | InChI=1S/C10H17NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h3-4,9-10,12H,1-2,5-8H2/t9-,10-/m0/s1 |
| InChIKey | XYDYDWBMKPWWRY-UWVGGRQHSA-N |
| XLogP | 1.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol?
The IUPAC name of trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol (CID 54494610) is trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol.
What is the SMILES notation for trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol?
The canonical SMILES for trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol is O[C@H]1CCCC[C@@H]1N1CC=CC1.
What is the InChIKey of trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol?
The InChIKey is XYDYDWBMKPWWRY-UWVGGRQHSA-N. The full InChI is InChI=1S/C10H17NO/c12-10-6-2-1-5-9(10)11-7-3-4-8-11/h3-4,9-10,12H,1-2,5-8H2/t9-,10-/m0/s1.
What are the key properties of trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol?
trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol has a molecular weight of 167.25 g/mol, XLogP of 1.16, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2S)-2-(2,5-dihydropyrrol-1-yl)cyclohexan-1-ol is sourced from PubChem (CID 54494610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).