C7H10N2O — CID 544953
2,3,6-trimethylpyrimidin-4-one (PubChem CID 544953) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 2,3,6-trimethylpyrimidin-4-one.
| Compound Name | 2,3,6-trimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 544953 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2,3,6-trimethylpyrimidin-4-one |
| SMILES | Cc1cc(=O)n(C)c(C)n1 |
| InChI | InChI=1S/C7H10N2O/c1-5-4-7(10)9(3)6(2)8-5/h4H,1-3H3 |
| InChIKey | DGWISBUXQOTURD-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |