C28H41ClN4O3 — CID 54495507
3-chloro-N-[6-(2,2-dimethylpropylamino)-6-oxohexyl]-N-propan-2-yl-5-[2-(pyridin-2-ylamino)ethoxy]benzamide (PubChem CID 54495507) has the molecular formula C28H41ClN4O3 and a molecular weight of 517.11 g/mol. Its IUPAC name is 3-chloro-N-[6-(2,2-dimethylpropylamino)-6-oxohexyl]-N-propan-2-yl-5-[2-(pyridin-2-ylamino)ethoxy]benzamide.
| Compound Name | 3-chloro-N-[6-(2,2-dimethylpropylamino)-6-oxohexyl]-N-propan-2-yl-5-[2-(pyridin-2-ylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 54495507 |
| Molecular Formula | C28H41ClN4O3 |
| Molecular Weight | 517.11 g/mol |
| Exact Mass | 516.29 |
| IUPAC Name | 3-chloro-N-[6-(2,2-dimethylpropylamino)-6-oxohexyl]-N-propan-2-yl-5-[2-(pyridin-2-ylamino)ethoxy]benzamide |
| SMILES | CC(C)N(CCCCCC(=O)NCC(C)(C)C)C(=O)c1cc(Cl)cc(OCCNc2ccccn2)c1 |
| InChI | InChI=1S/C28H41ClN4O3/c1-21(2)33(15-10-6-7-12-26(34)32-20-28(3,4)5)27(35)22-17-23(29)19-24(18-22)36-16-14-31-25-11-8-9-13-30-25/h8-9,11,13,17-19,21H,6-7,10,12,14-16,20H2,1-5H3,(H,30,31)(H,32,34) |
| InChIKey | XYUICESFXWUMOD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.11 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|