C25H27N3OS — CID 54495639
7-methoxy-1-[(1-methylpiperidin-3-yl)methyl]-3-(5-thiophen-3-yl-2-pyridinyl)indole (PubChem CID 54495639) has the molecular formula C25H27N3OS and a molecular weight of 417.58 g/mol. Its IUPAC name is 7-methoxy-1-[(1-methylpiperidin-3-yl)methyl]-3-(5-thiophen-3-yl-2-pyridinyl)indole.
| Compound Name | 7-methoxy-1-[(1-methylpiperidin-3-yl)methyl]-3-(5-thiophen-3-yl-2-pyridinyl)indole |
|---|---|
| PubChem CID | 54495639 |
| Molecular Formula | C25H27N3OS |
| Molecular Weight | 417.58 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 7-methoxy-1-[(1-methylpiperidin-3-yl)methyl]-3-(5-thiophen-3-yl-2-pyridinyl)indole |
| SMILES | COc1cccc2c(-c3ccc(-c4ccsc4)cn3)cn(CC3CCCN(C)C3)c12 |
| InChI | InChI=1S/C25H27N3OS/c1-27-11-4-5-18(14-27)15-28-16-22(21-6-3-7-24(29-2)25(21)28)23-9-8-19(13-26-23)20-10-12-30-17-20/h3,6-10,12-13,16-18H,4-5,11,14-15H2,1-2H3 |
| InChIKey | XYWLODFDYJGEKR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.58 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |