C25H25F3O5S — CID 54496058
ethyl 4-[1-[3,5,5-trimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate (PubChem CID 54496058) has the molecular formula C25H25F3O5S and a molecular weight of 494.53 g/mol. Its IUPAC name is ethyl 4-[1-[3,5,5-trimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate.
| Compound Name | ethyl 4-[1-[3,5,5-trimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 54496058 |
| Molecular Formula | C25H25F3O5S |
| Molecular Weight | 494.53 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | ethyl 4-[1-[3,5,5-trimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
| SMILES | C=C(c1ccc(C(=O)OCC)cc1)c1cc2c(cc1C)C(C)(C)CC=C2OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C25H25F3O5S/c1-6-32-23(29)18-9-7-17(8-10-18)16(3)19-14-20-21(13-15(19)2)24(4,5)12-11-22(20)33-34(30,31)25(26,27)28/h7-11,13-14H,3,6,12H2,1-2,4-5H3 |
| InChIKey | XZEURYXWGBPJHQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.53 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|