C17H32N4O2 — CID 54496087
1-[2-(3,4-diaminobutylamino)ethyl]-3-(4-methylhex-2-en-2-yl)pyrrole-2,5-diol (PubChem CID 54496087) has the molecular formula C17H32N4O2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[2-(3,4-diaminobutylamino)ethyl]-3-(4-methylhex-2-en-2-yl)pyrrole-2,5-diol.
| Compound Name | 1-[2-(3,4-diaminobutylamino)ethyl]-3-(4-methylhex-2-en-2-yl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 54496087 |
| Molecular Formula | C17H32N4O2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | 1-[2-(3,4-diaminobutylamino)ethyl]-3-(4-methylhex-2-en-2-yl)pyrrole-2,5-diol |
| SMILES | CCC(C)C=C(C)c1cc(O)n(CCNCCC(N)CN)c1O |
| InChI | InChI=1S/C17H32N4O2/c1-4-12(2)9-13(3)15-10-16(22)21(17(15)23)8-7-20-6-5-14(19)11-18/h9-10,12,14,20,22-23H,4-8,11,18-19H2,1-3H3 |
| InChIKey | XZFJPFBZUOBEMB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 109.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|