C14H28N2O2 — CID 54496164
N-butyl-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxamide (PubChem CID 54496164) has the molecular formula C14H28N2O2 and a molecular weight of 256.39 g/mol. Its IUPAC name is N-butyl-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxamide.
| Compound Name | N-butyl-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 54496164 |
| Molecular Formula | C14H28N2O2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.22 |
| IUPAC Name | N-butyl-4-hydroxy-2,2,6,6-tetramethylpiperidine-1-carboxamide |
| SMILES | CCCCNC(=O)N1C(C)(C)CC(O)CC1(C)C |
| InChI | InChI=1S/C14H28N2O2/c1-6-7-8-15-12(18)16-13(2,3)9-11(17)10-14(16,4)5/h11,17H,6-10H2,1-5H3,(H,15,18) |
| InChIKey | XZGRZUSRGLAUQG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|