C23H25F2NO2 — CID 54496319
9-(3,4-difluorophenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione (PubChem CID 54496319) has the molecular formula C23H25F2NO2 and a molecular weight of 385.45 g/mol. Its IUPAC name is 9-(3,4-difluorophenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione.
| Compound Name | 9-(3,4-difluorophenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
|---|---|
| PubChem CID | 54496319 |
| Molecular Formula | C23H25F2NO2 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 9-(3,4-difluorophenyl)-3,3,6,6-tetramethyl-2,4,5,7,8a,9-hexahydroacridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2C(=NC3=C(C(=O)CC(C)(C)C3)C2c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C23H25F2NO2/c1-22(2)8-15-20(17(27)10-22)19(12-5-6-13(24)14(25)7-12)21-16(26-15)9-23(3,4)11-18(21)28/h5-7,19-20H,8-11H2,1-4H3 |
| InChIKey | XZJFFPIPZYXFCS-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |