About 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile
2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile (PubChem CID 54496428) has the molecular formula C10H6ClF3N2O
and a molecular weight of 262.62 g/mol. Its IUPAC name is 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile.
Molecular Properties
| Compound Name | 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile |
| PubChem CID | 54496428 |
| Molecular Formula | C10H6ClF3N2O |
| Molecular Weight | 262.62 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile |
| SMILES | N#CCON=C(c1ccccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C10H6ClF3N2O/c11-8-4-2-1-3-7(8)9(10(12,13)14)16-17-6-5-15/h1-4H,6H2 |
| InChIKey | XZKUBTHEDDKZGG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile?
The IUPAC name of 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile (CID 54496428) is 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile.
What is the SMILES notation for 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile?
The canonical SMILES for 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile is N#CCON=C(c1ccccc1Cl)C(F)(F)F.
What is the InChIKey of 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile?
The InChIKey is XZKUBTHEDDKZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6ClF3N2O/c11-8-4-2-1-3-7(8)9(10(12,13)14)16-17-6-5-15/h1-4H,6H2.
What are the key properties of 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile?
2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile has a molecular weight of 262.62 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2-chlorophenyl)-2,2,2-trifluoroethylidene]amino]oxyacetonitrile is sourced from PubChem (CID 54496428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).