C17H16N6 — CID 54496754
2-[(6-methyl-1H-benzimidazol-2-yl)methyl]-3H-benzimidazole-5-carboximidamide (PubChem CID 54496754) has the molecular formula C17H16N6 and a molecular weight of 304.36 g/mol. Its IUPAC name is 2-[(6-methyl-1H-benzimidazol-2-yl)methyl]-3H-benzimidazole-5-carboximidamide.
| Compound Name | 2-[(6-methyl-1H-benzimidazol-2-yl)methyl]-3H-benzimidazole-5-carboximidamide |
|---|---|
| PubChem CID | 54496754 |
| Molecular Formula | C17H16N6 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 2-[(6-methyl-1H-benzimidazol-2-yl)methyl]-3H-benzimidazole-5-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2nc(Cc3nc4ccc(C)cc4[nH]3)[nH]c2c1 |
| InChI | InChI=1S/C17H16N6/c1-9-2-4-11-13(6-9)22-15(20-11)8-16-21-12-5-3-10(17(18)19)7-14(12)23-16/h2-7H,8H2,1H3,(H3,18,19)(H,20,22)(H,21,23) |
| InChIKey | XZQJSTGYACWMDV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 107.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|