About 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine
2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine (PubChem CID 54496914) has the molecular formula C25H31NO
and a molecular weight of 361.53 g/mol. Its IUPAC name is 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine.
Molecular Properties
| Compound Name | 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine |
| PubChem CID | 54496914 |
| Molecular Formula | C25H31NO |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine |
| SMILES | CCCCCC1CN=C(C=Cc2ccc(-c3ccc(CC)cc3)cc2)OC1 |
| InChI | InChI=1S/C25H31NO/c1-3-5-6-7-22-18-26-25(27-19-22)17-12-21-10-15-24(16-11-21)23-13-8-20(4-2)9-14-23/h8-17,22H,3-7,18-19H2,1-2H3 |
| InChIKey | XZTKHPMATOUPQQ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine?
The IUPAC name of 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine (CID 54496914) is 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine.
What is the SMILES notation for 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine?
The canonical SMILES for 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine is CCCCCC1CN=C(C=Cc2ccc(-c3ccc(CC)cc3)cc2)OC1.
What is the InChIKey of 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine?
The InChIKey is XZTKHPMATOUPQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31NO/c1-3-5-6-7-22-18-26-25(27-19-22)17-12-21-10-15-24(16-11-21)23-13-8-20(4-2)9-14-23/h8-17,22H,3-7,18-19H2,1-2H3.
What are the key properties of 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine?
2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine has a molecular weight of 361.53 g/mol, XLogP of 6.55, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(4-ethylphenyl)phenyl]ethenyl]-5-pentyl-5,6-dihydro-4H-1,3-oxazine is sourced from PubChem (CID 54496914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).