About 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide
2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide (PubChem CID 54496984) has the molecular formula C16H17NO3S
and a molecular weight of 303.38 g/mol. Its IUPAC name is 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide |
| PubChem CID | 54496984 |
| Molecular Formula | C16H17NO3S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide |
| SMILES | CC1=C(SCC(=O)NC(C)C)C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H17NO3S/c1-9(2)17-13(18)8-21-16-10(3)14(19)11-6-4-5-7-12(11)15(16)20/h4-7,9H,8H2,1-3H3,(H,17,18) |
| InChIKey | XZUNYRKUYMQQAI-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide?
The IUPAC name of 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide (CID 54496984) is 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide.
What is the SMILES notation for 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide?
The canonical SMILES for 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide is CC1=C(SCC(=O)NC(C)C)C(=O)c2ccccc2C1=O.
What is the InChIKey of 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide?
The InChIKey is XZUNYRKUYMQQAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO3S/c1-9(2)17-13(18)8-21-16-10(3)14(19)11-6-4-5-7-12(11)15(16)20/h4-7,9H,8H2,1-3H3,(H,17,18).
What are the key properties of 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide?
2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide has a molecular weight of 303.38 g/mol, XLogP of 2.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,4-dioxonaphthalen-2-yl)sulfanyl-N-propan-2-ylacetamide is sourced from PubChem (CID 54496984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).