About tris(3-ethoxypropyl) phosphite
tris(3-ethoxypropyl) phosphite (PubChem CID 54497287) has the molecular formula C15H33O6P
and a molecular weight of 340.40 g/mol. Its IUPAC name is tris(3-ethoxypropyl) phosphite.
Molecular Properties
| Compound Name | tris(3-ethoxypropyl) phosphite |
| PubChem CID | 54497287 |
| Molecular Formula | C15H33O6P |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | tris(3-ethoxypropyl) phosphite |
| SMILES | CCOCCCOP(OCCCOCC)OCCCOCC |
| InChI | InChI=1S/C15H33O6P/c1-4-16-10-7-13-19-22(20-14-8-11-17-5-2)21-15-9-12-18-6-3/h4-15H2,1-3H3 |
| InChIKey | XZZVAINYSPHORC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(3-ethoxypropyl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(3-ethoxypropyl) phosphite?
The IUPAC name of tris(3-ethoxypropyl) phosphite (CID 54497287) is tris(3-ethoxypropyl) phosphite.
What is the SMILES notation for tris(3-ethoxypropyl) phosphite?
The canonical SMILES for tris(3-ethoxypropyl) phosphite is CCOCCCOP(OCCCOCC)OCCCOCC.
What is the InChIKey of tris(3-ethoxypropyl) phosphite?
The InChIKey is XZZVAINYSPHORC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33O6P/c1-4-16-10-7-13-19-22(20-14-8-11-17-5-2)21-15-9-12-18-6-3/h4-15H2,1-3H3.
What are the key properties of tris(3-ethoxypropyl) phosphite?
tris(3-ethoxypropyl) phosphite has a molecular weight of 340.40 g/mol, XLogP of 3.54, 18 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tris(3-ethoxypropyl) phosphite is sourced from PubChem (CID 54497287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).