methyl 2-methylidene-3-phenyldecanoate

C18H26O2 — CID 54497429

IUPACmethyl 2-methylidene-3-phenyldecanoate
SMILESC=C(C(=O)OC)C(CCCCCCC)c1ccccc1
InChIInChI=1S/C18H26O2/c1-4-5-6-7-11-14-17(15(2)18(19)20-3)16-12-9-8-10-13-16/h8-10,12-13,17H,2,4-7,11,14H2,1,3H3
InChIKeyCBEHZUMIQCZJPD-UHFFFAOYSA-N
MW274.40 g/mol
LogP4.86
Rot. Bonds9

About methyl 2-methylidene-3-phenyldecanoate

methyl 2-methylidene-3-phenyldecanoate (PubChem CID 54497429) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is methyl 2-methylidene-3-phenyldecanoate.

Molecular Properties

Compound Namemethyl 2-methylidene-3-phenyldecanoate
PubChem CID54497429
Molecular FormulaC18H26O2
Molecular Weight274.40 g/mol
Exact Mass274.19
IUPAC Namemethyl 2-methylidene-3-phenyldecanoate
SMILESC=C(C(=O)OC)C(CCCCCCC)c1ccccc1
InChIInChI=1S/C18H26O2/c1-4-5-6-7-11-14-17(15(2)18(19)20-3)16-12-9-8-10-13-16/h8-10,12-13,17H,2,4-7,11,14H2,1,3H3
InChIKeyCBEHZUMIQCZJPD-UHFFFAOYSA-N
XLogP4.86
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds9
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500274.40
LogP ≤ 54.86
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl 2-methylidene-3-phenyldecanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-methylidene-3-phenyldecanoate?
The IUPAC name of methyl 2-methylidene-3-phenyldecanoate (CID 54497429) is methyl 2-methylidene-3-phenyldecanoate.
What is the SMILES notation for methyl 2-methylidene-3-phenyldecanoate?
The canonical SMILES for methyl 2-methylidene-3-phenyldecanoate is C=C(C(=O)OC)C(CCCCCCC)c1ccccc1.
What is the InChIKey of methyl 2-methylidene-3-phenyldecanoate?
The InChIKey is CBEHZUMIQCZJPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26O2/c1-4-5-6-7-11-14-17(15(2)18(19)20-3)16-12-9-8-10-13-16/h8-10,12-13,17H,2,4-7,11,14H2,1,3H3.
What are the key properties of methyl 2-methylidene-3-phenyldecanoate?
methyl 2-methylidene-3-phenyldecanoate has a molecular weight of 274.40 g/mol, XLogP of 4.86, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylidene-3-phenyldecanoate is sourced from PubChem (CID 54497429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).