About 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile
2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile (PubChem CID 54497637) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile.
Molecular Properties
| Compound Name | 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile |
| PubChem CID | 54497637 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile |
| SMILES | CC1(C)C2CCC1[C@@H](CC(N)C#N)C2 |
| InChI | InChI=1S/C12H20N2/c1-12(2)9-3-4-11(12)8(5-9)6-10(14)7-13/h8-11H,3-6,14H2,1-2H3/t8-,9?,10?,11?/m1/s1 |
| InChIKey | YAFYSWOHWASWCD-XUHYKBHQSA-N |
| XLogP | 2.30 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile?
The IUPAC name of 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile (CID 54497637) is 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile.
What is the SMILES notation for 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile?
The canonical SMILES for 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile is CC1(C)C2CCC1[C@@H](CC(N)C#N)C2.
What is the InChIKey of 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile?
The InChIKey is YAFYSWOHWASWCD-XUHYKBHQSA-N. The full InChI is InChI=1S/C12H20N2/c1-12(2)9-3-4-11(12)8(5-9)6-10(14)7-13/h8-11H,3-6,14H2,1-2H3/t8-,9?,10?,11?/m1/s1.
What are the key properties of 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile?
2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile has a molecular weight of 192.31 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(2R)-7,7-dimethyl-2-bicyclo[2.2.1]heptanyl]propanenitrile is sourced from PubChem (CID 54497637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).