C23H23NO7 — CID 54497717
3-benzylidene-1-(methoxymethoxy)-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrrolidine-2,5-dione (PubChem CID 54497717) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is 3-benzylidene-1-(methoxymethoxy)-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-benzylidene-1-(methoxymethoxy)-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 54497717 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 3-benzylidene-1-(methoxymethoxy)-4-[(3,4,5-trimethoxyphenyl)methylidene]pyrrolidine-2,5-dione |
| SMILES | COCON1C(=O)C(=Cc2ccccc2)C(=Cc2cc(OC)c(OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C23H23NO7/c1-27-14-31-24-22(25)17(10-15-8-6-5-7-9-15)18(23(24)26)11-16-12-19(28-2)21(30-4)20(13-16)29-3/h5-13H,14H2,1-4H3 |
| InChIKey | YAHHLBSDEIQTCQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|