C21H30F3NO4SSi — CID 54498077
ethyl N-[6-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutoxy]-1-benzothiophen-3-yl]carbamate (PubChem CID 54498077) has the molecular formula C21H30F3NO4SSi and a molecular weight of 477.62 g/mol. Its IUPAC name is ethyl N-[6-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutoxy]-1-benzothiophen-3-yl]carbamate.
| Compound Name | ethyl N-[6-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutoxy]-1-benzothiophen-3-yl]carbamate |
|---|---|
| PubChem CID | 54498077 |
| Molecular Formula | C21H30F3NO4SSi |
| Molecular Weight | 477.62 g/mol |
| Exact Mass | 477.16 |
| IUPAC Name | ethyl N-[6-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,4-trifluorobutoxy]-1-benzothiophen-3-yl]carbamate |
| SMILES | CCOC(=O)Nc1csc2cc(OCC[C@@H](O[Si](C)(C)C(C)(C)C)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C21H30F3NO4SSi/c1-7-27-19(26)25-16-13-30-17-12-14(8-9-15(16)17)28-11-10-18(21(22,23)24)29-31(5,6)20(2,3)4/h8-9,12-13,18H,7,10-11H2,1-6H3,(H,25,26)/t18-/m1/s1 |
| InChIKey | YANKQJGPDOIPGD-GOSISDBHSA-N |
| XLogP | 7.19 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|