C62H110O9 — CID 54498305
[2-[(2S,3R,4S)-3,4-di(octadec-9-enoyloxy)oxolan-2-yl]-1,3-dioxolan-2-yl]methyl octadec-9-enoate (PubChem CID 54498305) has the molecular formula C62H110O9 and a molecular weight of 999.55 g/mol. Its IUPAC name is [2-[(2S,3R,4S)-3,4-di(octadec-9-enoyloxy)oxolan-2-yl]-1,3-dioxolan-2-yl]methyl octadec-9-enoate.
| Compound Name | [2-[(2S,3R,4S)-3,4-di(octadec-9-enoyloxy)oxolan-2-yl]-1,3-dioxolan-2-yl]methyl octadec-9-enoate |
|---|---|
| PubChem CID | 54498305 |
| Molecular Formula | C62H110O9 |
| Molecular Weight | 999.55 g/mol |
| Exact Mass | 998.81 |
| IUPAC Name | [2-[(2S,3R,4S)-3,4-di(octadec-9-enoyloxy)oxolan-2-yl]-1,3-dioxolan-2-yl]methyl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC1([C@H]2OC[C@H](OC(=O)CCCCCCCC=CCCCCCCCC)[C@H]2OC(=O)CCCCCCCC=CCCCCCCCC)OCCO1 |
| InChI | InChI=1S/C62H110O9/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-57(63)67-55-62(68-52-53-69-62)61-60(71-59(65)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)56(54-66-61)70-58(64)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h25-30,56,60-61H,4-24,31-55H2,1-3H3/t56-,60+,61-/m0/s1 |
| InChIKey | YAQYUGIGVIYPSG-IKURSSGNSA-N |
| XLogP | 17.61 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.55 |
| LogP ≤ 5 | 17.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|