About 4-cyclopropyl-3,3-dimethylazetidin-2-one
4-cyclopropyl-3,3-dimethylazetidin-2-one (PubChem CID 54498497) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is 4-cyclopropyl-3,3-dimethylazetidin-2-one.
Molecular Properties
| Compound Name | 4-cyclopropyl-3,3-dimethylazetidin-2-one |
| PubChem CID | 54498497 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | 4-cyclopropyl-3,3-dimethylazetidin-2-one |
| SMILES | CC1(C)C(=O)NC1C1CC1 |
| InChI | InChI=1S/C8H13NO/c1-8(2)6(5-3-4-5)9-7(8)10/h5-6H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | YAUJPRYRAHUFLA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-cyclopropyl-3,3-dimethylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-3,3-dimethylazetidin-2-one?
The IUPAC name of 4-cyclopropyl-3,3-dimethylazetidin-2-one (CID 54498497) is 4-cyclopropyl-3,3-dimethylazetidin-2-one.
What is the SMILES notation for 4-cyclopropyl-3,3-dimethylazetidin-2-one?
The canonical SMILES for 4-cyclopropyl-3,3-dimethylazetidin-2-one is CC1(C)C(=O)NC1C1CC1.
What is the InChIKey of 4-cyclopropyl-3,3-dimethylazetidin-2-one?
The InChIKey is YAUJPRYRAHUFLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO/c1-8(2)6(5-3-4-5)9-7(8)10/h5-6H,3-4H2,1-2H3,(H,9,10).
What are the key properties of 4-cyclopropyl-3,3-dimethylazetidin-2-one?
4-cyclopropyl-3,3-dimethylazetidin-2-one has a molecular weight of 139.20 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-3,3-dimethylazetidin-2-one is sourced from PubChem (CID 54498497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).