C12H10O9 — CID 54498950
2-[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 54498950) has the molecular formula C12H10O9 and a molecular weight of 298.20 g/mol. Its IUPAC name is 2-[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 54498950 |
| Molecular Formula | C12H10O9 |
| Molecular Weight | 298.20 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-[2-(3,6-dioxocyclohexa-1,4-dien-1-yl)oxy-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C1C=CC(=O)C(OC(=O)CC(O)(CC(=O)O)C(=O)O)=C1 |
| InChI | InChI=1S/C12H10O9/c13-6-1-2-7(14)8(3-6)21-10(17)5-12(20,11(18)19)4-9(15)16/h1-3,20H,4-5H2,(H,15,16)(H,18,19) |
| InChIKey | YBBZRGYLLZGPGT-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.20 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|