C12H16O4S — CID 54499710
(2S,3S,4R,5S,6R)-2-methyl-6-phenylsulfanyloxane-3,4,5-triol (PubChem CID 54499710) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is (2S,3S,4R,5S,6R)-2-methyl-6-phenylsulfanyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6R)-2-methyl-6-phenylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 54499710 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | (2S,3S,4R,5S,6R)-2-methyl-6-phenylsulfanyloxane-3,4,5-triol |
| SMILES | C[C@@H]1O[C@H](Sc2ccccc2)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16O4S/c1-7-9(13)10(14)11(15)12(16-7)17-8-5-3-2-4-6-8/h2-7,9-15H,1H3/t7-,9+,10+,11-,12+/m0/s1 |
| InChIKey | YBOVKFRFMWFKCC-VSYPEIIYSA-N |
| XLogP | 0.61 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |