C16H19NOSi — CID 54499747
2,2,3-trimethyl-6-naphthalen-2-yl-3,4-dihydro-1,5,2-oxazasiline (PubChem CID 54499747) has the molecular formula C16H19NOSi and a molecular weight of 269.42 g/mol. Its IUPAC name is 2,2,3-trimethyl-6-naphthalen-2-yl-3,4-dihydro-1,5,2-oxazasiline.
| Compound Name | 2,2,3-trimethyl-6-naphthalen-2-yl-3,4-dihydro-1,5,2-oxazasiline |
|---|---|
| PubChem CID | 54499747 |
| Molecular Formula | C16H19NOSi |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2,2,3-trimethyl-6-naphthalen-2-yl-3,4-dihydro-1,5,2-oxazasiline |
| SMILES | CC1CN=C(c2ccc3ccccc3c2)O[Si]1(C)C |
| InChI | InChI=1S/C16H19NOSi/c1-12-11-17-16(18-19(12,2)3)15-9-8-13-6-4-5-7-14(13)10-15/h4-10,12H,11H2,1-3H3 |
| InChIKey | YBPKWVNKLASKTJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|