C7H10N4O4S2 — CID 54499884
2-methyl-4-oxo-2-sulfamoyl-4-(1,3,4-thiadiazol-2-yl)butanamide (PubChem CID 54499884) has the molecular formula C7H10N4O4S2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-methyl-4-oxo-2-sulfamoyl-4-(1,3,4-thiadiazol-2-yl)butanamide.
| Compound Name | 2-methyl-4-oxo-2-sulfamoyl-4-(1,3,4-thiadiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 54499884 |
| Molecular Formula | C7H10N4O4S2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 2-methyl-4-oxo-2-sulfamoyl-4-(1,3,4-thiadiazol-2-yl)butanamide |
| SMILES | CC(CC(=O)c1nncs1)(C(N)=O)S(N)(=O)=O |
| InChI | InChI=1S/C7H10N4O4S2/c1-7(6(8)13,17(9,14)15)2-4(12)5-11-10-3-16-5/h3H,2H2,1H3,(H2,8,13)(H2,9,14,15) |
| InChIKey | YBRLHPGDTVXZOC-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |