About 6-ethoxy-1,2-benzothiazol-3-one
6-ethoxy-1,2-benzothiazol-3-one (PubChem CID 54500484) has the molecular formula C9H9NO2S
and a molecular weight of 195.24 g/mol. Its IUPAC name is 6-ethoxy-1,2-benzothiazol-3-one.
Molecular Properties
| Compound Name | 6-ethoxy-1,2-benzothiazol-3-one |
| PubChem CID | 54500484 |
| Molecular Formula | C9H9NO2S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.04 |
| IUPAC Name | 6-ethoxy-1,2-benzothiazol-3-one |
| SMILES | CCOc1ccc2c(=O)[nH]sc2c1 |
| InChI | InChI=1S/C9H9NO2S/c1-2-12-6-3-4-7-8(5-6)13-10-9(7)11/h3-5H,2H2,1H3,(H,10,11) |
| InChIKey | YCBOEZYEWZSOGQ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-ethoxy-1,2-benzothiazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-1,2-benzothiazol-3-one?
The IUPAC name of 6-ethoxy-1,2-benzothiazol-3-one (CID 54500484) is 6-ethoxy-1,2-benzothiazol-3-one.
What is the SMILES notation for 6-ethoxy-1,2-benzothiazol-3-one?
The canonical SMILES for 6-ethoxy-1,2-benzothiazol-3-one is CCOc1ccc2c(=O)[nH]sc2c1.
What is the InChIKey of 6-ethoxy-1,2-benzothiazol-3-one?
The InChIKey is YCBOEZYEWZSOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO2S/c1-2-12-6-3-4-7-8(5-6)13-10-9(7)11/h3-5H,2H2,1H3,(H,10,11).
What are the key properties of 6-ethoxy-1,2-benzothiazol-3-one?
6-ethoxy-1,2-benzothiazol-3-one has a molecular weight of 195.24 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-1,2-benzothiazol-3-one is sourced from PubChem (CID 54500484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).