C32H37Cl2N3O4 — CID 54500507
methyl 2-[5-[3-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]-benzylamino]hexoxy]prop-1-ynyl]-3-pyridinyl]acetate (PubChem CID 54500507) has the molecular formula C32H37Cl2N3O4 and a molecular weight of 598.57 g/mol. Its IUPAC name is methyl 2-[5-[3-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]-benzylamino]hexoxy]prop-1-ynyl]-3-pyridinyl]acetate.
| Compound Name | methyl 2-[5-[3-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]-benzylamino]hexoxy]prop-1-ynyl]-3-pyridinyl]acetate |
|---|---|
| PubChem CID | 54500507 |
| Molecular Formula | C32H37Cl2N3O4 |
| Molecular Weight | 598.57 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | methyl 2-[5-[3-[6-[[2-(4-amino-3,5-dichlorophenyl)-2-hydroxyethyl]-benzylamino]hexoxy]prop-1-ynyl]-3-pyridinyl]acetate |
| SMILES | COC(=O)Cc1cncc(C#CCOCCCCCCN(Cc2ccccc2)CC(O)c2cc(Cl)c(N)c(Cl)c2)c1 |
| InChI | InChI=1S/C32H37Cl2N3O4/c1-40-31(39)17-26-16-25(20-36-21-26)12-9-15-41-14-8-3-2-7-13-37(22-24-10-5-4-6-11-24)23-30(38)27-18-28(33)32(35)29(34)19-27/h4-6,10-11,16,18-21,30,38H,2-3,7-8,13-15,17,22-23,35H2,1H3 |
| InChIKey | YCBUVBHEXZEGEW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 97.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.57 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|