C22H24F3N3O3S — CID 54500566
[5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl] trifluoromethanesulfonate (PubChem CID 54500566) has the molecular formula C22H24F3N3O3S and a molecular weight of 467.51 g/mol. Its IUPAC name is [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl] trifluoromethanesulfonate.
| Compound Name | [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 54500566 |
| Molecular Formula | C22H24F3N3O3S |
| Molecular Weight | 467.51 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [5-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-2-yl] trifluoromethanesulfonate |
| SMILES | CCc1nc2c(C)cc(C)nc2n1C1CCCCc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C22H24F3N3O3S/c1-4-19-27-20-13(2)11-14(3)26-21(20)28(19)18-8-6-5-7-15-12-16(9-10-17(15)18)31-32(29,30)22(23,24)25/h9-12,18H,4-8H2,1-3H3 |
| InChIKey | YCCRAQDHRNVUEK-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.51 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|