C14H14N2O4 — CID 545006
ethyl 3-methyl-2,4-dioxo-6-phenyl-1H-pyrimidine-5-carboxylate (PubChem CID 545006) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl 3-methyl-2,4-dioxo-6-phenyl-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 3-methyl-2,4-dioxo-6-phenyl-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 545006 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | ethyl 3-methyl-2,4-dioxo-6-phenyl-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)[nH]c(=O)n(C)c1=O |
| InChI | InChI=1S/C14H14N2O4/c1-3-20-13(18)10-11(9-7-5-4-6-8-9)15-14(19)16(2)12(10)17/h4-8H,3H2,1-2H3,(H,15,19) |
| InChIKey | PITLACKUKUNAHX-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |