C10H16N2O3S — CID 545007
5,5-diethyl-1-(methylsulfanylmethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 545007) has the molecular formula C10H16N2O3S and a molecular weight of 244.32 g/mol. Its IUPAC name is 5,5-diethyl-1-(methylsulfanylmethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5,5-diethyl-1-(methylsulfanylmethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 545007 |
| Molecular Formula | C10H16N2O3S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 5,5-diethyl-1-(methylsulfanylmethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCC1(CC)C(=O)NC(=O)N(CSC)C1=O |
| InChI | InChI=1S/C10H16N2O3S/c1-4-10(5-2)7(13)11-9(15)12(6-16-3)8(10)14/h4-6H2,1-3H3,(H,11,13,15) |
| InChIKey | QVXZMYYMGSYWEH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|