C17H10I3N3O4 — CID 54500803
1-(5-hydroxy-2,3-dioxo-1H-1-benzazepin-4-yl)-3-(2,4,6-triiodophenyl)urea (PubChem CID 54500803) has the molecular formula C17H10I3N3O4 and a molecular weight of 701.00 g/mol. Its IUPAC name is 1-(5-hydroxy-2,3-dioxo-1H-1-benzazepin-4-yl)-3-(2,4,6-triiodophenyl)urea.
| Compound Name | 1-(5-hydroxy-2,3-dioxo-1H-1-benzazepin-4-yl)-3-(2,4,6-triiodophenyl)urea |
|---|---|
| PubChem CID | 54500803 |
| Molecular Formula | C17H10I3N3O4 |
| Molecular Weight | 701.00 g/mol |
| Exact Mass | 700.78 |
| IUPAC Name | 1-(5-hydroxy-2,3-dioxo-1H-1-benzazepin-4-yl)-3-(2,4,6-triiodophenyl)urea |
| SMILES | O=C(Nc1c(I)cc(I)cc1I)Nc1c(O)c2ccccc2[nH]c(=O)c1=O |
| InChI | InChI=1S/C17H10I3N3O4/c18-7-5-9(19)12(10(20)6-7)22-17(27)23-13-14(24)8-3-1-2-4-11(8)21-16(26)15(13)25/h1-6H,(H4,21,22,23,24,25,26,27) |
| InChIKey | YCGYIYITUMMKTR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 111.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.00 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|