C15H17F2NO3 — CID 54500951
methyl 2-(2,6-difluorophenyl)-2-(1-methylcyclopentyl)oxyiminoacetate (PubChem CID 54500951) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is methyl 2-(2,6-difluorophenyl)-2-(1-methylcyclopentyl)oxyiminoacetate.
| Compound Name | methyl 2-(2,6-difluorophenyl)-2-(1-methylcyclopentyl)oxyiminoacetate |
|---|---|
| PubChem CID | 54500951 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | methyl 2-(2,6-difluorophenyl)-2-(1-methylcyclopentyl)oxyiminoacetate |
| SMILES | COC(=O)C(=NOC1(C)CCCC1)c1c(F)cccc1F |
| InChI | InChI=1S/C15H17F2NO3/c1-15(8-3-4-9-15)21-18-13(14(19)20-2)12-10(16)6-5-7-11(12)17/h5-7H,3-4,8-9H2,1-2H3 |
| InChIKey | YCJLKLVTZPTOMA-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|