C32H22N4O8S2 — CID 54501100
1-[3-[[3,5-bis(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]disulfanyl]-5-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-dione (PubChem CID 54501100) has the molecular formula C32H22N4O8S2 and a molecular weight of 654.68 g/mol. Its IUPAC name is 1-[3-[[3,5-bis(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]disulfanyl]-5-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[3-[[3,5-bis(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]disulfanyl]-5-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 54501100 |
| Molecular Formula | C32H22N4O8S2 |
| Molecular Weight | 654.68 g/mol |
| Exact Mass | 654.09 |
| IUPAC Name | 1-[3-[[3,5-bis(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]disulfanyl]-5-(3-methyl-2,5-dioxopyrrol-1-yl)phenyl]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(c2cc(SSc3cc(N4C(=O)C=C(C)C4=O)cc(N4C(=O)C=C(C)C4=O)c3)cc(N3C(=O)C=C(C)C3=O)c2)C1=O |
| InChI | InChI=1S/C32H22N4O8S2/c1-15-5-25(37)33(29(15)41)19-9-20(34-26(38)6-16(2)30(34)42)12-23(11-19)45-46-24-13-21(35-27(39)7-17(3)31(35)43)10-22(14-24)36-28(40)8-18(4)32(36)44/h5-14H,1-4H3 |
| InChIKey | YCMCVWDWAVDZLQ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 149.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|