C24H28O — CID 54501397
2,3,6,7,8-pentamethyl-4-(3,4,5-trimethylphenyl)naphthalen-1-ol (PubChem CID 54501397) has the molecular formula C24H28O and a molecular weight of 332.49 g/mol. Its IUPAC name is 2,3,6,7,8-pentamethyl-4-(3,4,5-trimethylphenyl)naphthalen-1-ol.
| Compound Name | 2,3,6,7,8-pentamethyl-4-(3,4,5-trimethylphenyl)naphthalen-1-ol |
|---|---|
| PubChem CID | 54501397 |
| Molecular Formula | C24H28O |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 2,3,6,7,8-pentamethyl-4-(3,4,5-trimethylphenyl)naphthalen-1-ol |
| SMILES | Cc1cc(-c2c(C)c(C)c(O)c3c(C)c(C)c(C)cc23)cc(C)c1C |
| InChI | InChI=1S/C24H28O/c1-12-9-20(10-13(2)15(12)4)22-18(7)19(8)24(25)23-17(6)16(5)14(3)11-21(22)23/h9-11,25H,1-8H3 |
| InChIKey | YCRIZQLELUUJFY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |