C14H16O4 — CID 54501731
2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-3,4-diol (PubChem CID 54501731) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-3,4-diol.
| Compound Name | 2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-3,4-diol |
|---|---|
| PubChem CID | 54501731 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decane-3,4-diol |
| SMILES | CC#CC#CC=C1OC2(CCCCO2)C(O)C1O |
| InChI | InChI=1S/C14H16O4/c1-2-3-4-5-8-11-12(15)13(16)14(18-11)9-6-7-10-17-14/h8,12-13,15-16H,6-7,9-10H2,1H3 |
| InChIKey | YCXFYWBMQJMDBX-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|