C22H24N2O3 — CID 54501821
7-hexan-3-yl-5-phenyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one (PubChem CID 54501821) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 7-hexan-3-yl-5-phenyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one.
| Compound Name | 7-hexan-3-yl-5-phenyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one |
|---|---|
| PubChem CID | 54501821 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 7-hexan-3-yl-5-phenyl-9H-[1,3]dioxolo[4,5-h][2,3]benzodiazepin-8-one |
| SMILES | CCCC(CC)N1N=C(c2ccccc2)c2cc3c(cc2CC1=O)OCO3 |
| InChI | InChI=1S/C22H24N2O3/c1-3-8-17(4-2)24-21(25)12-16-11-19-20(27-14-26-19)13-18(16)22(23-24)15-9-6-5-7-10-15/h5-7,9-11,13,17H,3-4,8,12,14H2,1-2H3 |
| InChIKey | YCYQKANRLUEHHX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |