About [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate
[2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate (PubChem CID 54501845) has the molecular formula C7H11N3O4
and a molecular weight of 201.18 g/mol. Its IUPAC name is [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate.
Molecular Properties
| Compound Name | [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate |
| PubChem CID | 54501845 |
| Molecular Formula | C7H11N3O4 |
| Molecular Weight | 201.18 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate |
| SMILES | CNCC(=O)OC(=O)N1C[C@H](N)C1=O |
| InChI | InChI=1S/C7H11N3O4/c1-9-2-5(11)14-7(13)10-3-4(8)6(10)12/h4,9H,2-3,8H2,1H3/t4-/m0/s1 |
| InChIKey | YCZBBPRYKIFMAQ-BYPYZUCNSA-N |
| XLogP | -1.96 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.18 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate?
The IUPAC name of [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate (CID 54501845) is [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate.
What is the SMILES notation for [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate?
The canonical SMILES for [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate is CNCC(=O)OC(=O)N1C[C@H](N)C1=O.
What is the InChIKey of [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate?
The InChIKey is YCZBBPRYKIFMAQ-BYPYZUCNSA-N. The full InChI is InChI=1S/C7H11N3O4/c1-9-2-5(11)14-7(13)10-3-4(8)6(10)12/h4,9H,2-3,8H2,1H3/t4-/m0/s1.
What are the key properties of [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate?
[2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate has a molecular weight of 201.18 g/mol, XLogP of -1.96, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(methylamino)acetyl] (3S)-3-amino-2-oxoazetidine-1-carboxylate is sourced from PubChem (CID 54501845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).